CAS 1025800-09-2 is the registry number for ethyl 2-nitrilo-3-((3-(1,1,2,2-tetrafluoroethoxy)phenyl)amino)prop-2-enoate. Offered by: Biosynth. Available pack sizes: 250mg.
Ethyl (Z)-2-cyano-3-[3-(1,1,2,2-tetrafluoroethoxy)anilino]prop-2-enoate (CAS 1025800-09-2) is a chemical compound with the molecular formula C14H12F4N2O3 and a molecular weight of 332.25 g/mol. IUPAC name: ethyl (Z)-2-cyano-3-[3-(1,1,2,2-tetrafluoroethoxy)anilino]prop-2-enoate. InChIKey: OOYDXVRWKKXOOP-HJWRWDBZSA-N.
| Molecular formula | C14H12F4N2O3 |
|---|---|
| Molecular weight | 332.25 g/mol |
| IUPAC name | ethyl (Z)-2-cyano-3-[3-(1,1,2,2-tetrafluoroethoxy)anilino]prop-2-enoate |
| InChIKey | OOYDXVRWKKXOOP-HJWRWDBZSA-N |
| SMILES | CCOC(=O)/C(=C\NC1=CC(=CC=C1)OC(C(F)F)(F)F)/C#N |
Computed by PubChem (NCBI)