CAS 102593-74-8 appears in our catalog under these names: 2–Allyl–4,6–dibenzoylresorcinol, 2-Allyl-4,6-dibenzoylresorcinol, 98% , 2-Allyl-4,6-dibenzoylresorcinol 98%, 2-Allyl-4,6-dibenzoylresorcinol, 98%, 98%, 2-ALLYL-4,6-DIBENZOYLRESORCINOL, 98%. Offered by: GLPBio, Thermo Scientific (Alfa Aesar), Ambeed, Chemat, Fluorochem. Available pack sizes: 100g, 25g, 5g, 500g, 1g, 250mg.
(5-benzoyl-2,4-dihydroxy-3-prop-2-enylphenyl)-phenylmethanone (CAS 102593-74-8) is a chemical compound with the molecular formula C23H18O4 and a molecular weight of 358.4 g/mol. IUPAC name: (5-benzoyl-2,4-dihydroxy-3-prop-2-enylphenyl)-phenylmethanone. InChIKey: FSYGSBMXRNPJAD-UHFFFAOYSA-N.
| Molecular formula | C23H18O4 |
|---|---|
| Molecular weight | 358.4 g/mol |
| IUPAC name | (5-benzoyl-2,4-dihydroxy-3-prop-2-enylphenyl)-phenylmethanone |
| InChIKey | FSYGSBMXRNPJAD-UHFFFAOYSA-N |
| SMILES | C=CCC1=C(C(=CC(=C1O)C(=O)C2=CC=CC=C2)C(=O)C3=CC=CC=C3)O |
Computed by PubChem (NCBI)