CAS 102601-60-5 appears in our catalog under these names: Co(iii) protoporphyrin ix chloride, 95%, Cobaltic Protoporphyrin IX chloride/ min. 98%, Cobaltic Protoporphyrin IX (chloride), Co(III) protoporphyrin IX chloride 95%, COBALTIC PROTOPORPHYRIN IX CHLORIDE. Offered by: Combi-blocks, TargetMol, GLPBio, Ambeed, Sigma-Aldrich. Available pack sizes: 250mg, 1g, 100mg, 5mg, 10mg, 25mg, 50mg, 25 mg.
3-[18-(2-carboxyethyl)-8,13-bis(ethenyl)-3,7,12,17-tetramethylporphyrin-21,23-diid-2-yl]propanoic acid;chlorocobalt(2+) (CAS 102601-60-5) is a chemical compound with the molecular formula C34H32ClCoN4O4 and a molecular weight of 655.0 g/mol. IUPAC name: 3-[18-(2-carboxyethyl)-8,13-bis(ethenyl)-3,7,12,17-tetramethylporphyrin-21,23-diid-2-yl]propanoic acid;chlorocobalt(2+). InChIKey: WWNXKQFLDNSNDN-UHFFFAOYSA-K.
| Molecular formula | C34H32ClCoN4O4 |
|---|---|
| Molecular weight | 655.0 g/mol |
| IUPAC name | 3-[18-(2-carboxyethyl)-8,13-bis(ethenyl)-3,7,12,17-tetramethylporphyrin-21,23-diid-2-yl]propanoic acid;chlorocobalt(2+) |
| InChIKey | WWNXKQFLDNSNDN-UHFFFAOYSA-K |
| SMILES | CC1=C(C2=CC3=NC(=CC4=C(C(=C([N-]4)C=C5C(=C(C(=N5)C=C1[N-]2)C)C=C)C)C=C)C(=C3CCC(=O)O)C)CCC(=O)O.Cl[Co+2] |
Computed by PubChem (NCBI)