CAS 1026042-12-5 appears in our catalog under these names: Candesartan Cilexetil Impurity 19, Candesartan Cilexetil Impurity 10, Candesartan Cilexetil Methoxy Analogue, >95% (HPLC), Candesartan cilexetil methoxy analogue, Candesartan impurity 7. Offered by: Chemat Brand, Hubei YoungXin, TRC, Biosynth, MedChemExpress. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 1mg, Get quote.
1-cyclohexyloxycarbonyloxyethyl 2-methoxy-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]benzimidazole-4-carboxylate (CAS 1026042-12-5) is a chemical compound with the molecular formula C32H32N6O6 and a molecular weight of 596.6 g/mol. IUPAC name: 1-cyclohexyloxycarbonyloxyethyl 2-methoxy-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]benzimidazole-4-carboxylate. InChIKey: ICNSKCNGTUJNOH-UHFFFAOYSA-N.
| Molecular formula | C32H32N6O6 |
|---|---|
| Molecular weight | 596.6 g/mol |
| IUPAC name | 1-cyclohexyloxycarbonyloxyethyl 2-methoxy-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]benzimidazole-4-carboxylate |
| InChIKey | ICNSKCNGTUJNOH-UHFFFAOYSA-N |
| SMILES | CC(OC(=O)C1=C2C(=CC=C1)N=C(N2CC3=CC=C(C=C3)C4=CC=CC=C4C5=NNN=N5)OC)OC(=O)OC6CCCCC6 |
Computed by PubChem (NCBI)