CAS 1026075-53-5 appears in our catalog under these names: Timolol EP Impurity E, Timolol Maleate EP Impurity E, Silodosin Impurity H, (S, Z)-4-((1-(tert-butylamino)-3-((4-morpholino-1, 2, 5- thiadiazol-3-yl)oxy)propan-2-yl)oxy)-4-oxobut-2-enoic acid, 95%, 95%, Timolol impurity 1, 98.75%. Offered by: Chemat Brand, Chemat, MedChemExpress, Fluorochem, Hubei YoungXin. Available pack sizes: on request, 1mg, 5mg, 10mg, 10 mg, 1 mg, 5 mg, 25mg.
(Z)-4-[(2S)-1-(tert-butylamino)-3-[(4-morpholin-4-yl-1,2,5-thiadiazol-3-yl)oxy]propan-2-yl]oxy-4-oxobut-2-enoic acid (CAS 1026075-53-5) is a chemical compound with the molecular formula C17H26N4O6S and a molecular weight of 414.5 g/mol. IUPAC name: (Z)-4-[(2S)-1-(tert-butylamino)-3-[(4-morpholin-4-yl-1,2,5-thiadiazol-3-yl)oxy]propan-2-yl]oxy-4-oxobut-2-enoic acid. InChIKey: MGIAXRFZDNBKRF-RXNFCKPNSA-N.
| Molecular formula | C17H26N4O6S |
|---|---|
| Molecular weight | 414.5 g/mol |
| IUPAC name | (Z)-4-[(2S)-1-(tert-butylamino)-3-[(4-morpholin-4-yl-1,2,5-thiadiazol-3-yl)oxy]propan-2-yl]oxy-4-oxobut-2-enoic acid |
| InChIKey | MGIAXRFZDNBKRF-RXNFCKPNSA-N |
| SMILES | CC(C)(C)NC[C@@H](COC1=NSN=C1N2CCOCC2)OC(=O)/C=C\C(=O)O |
Computed by PubChem (NCBI)