CAS 102626-53-9 is the registry number for 2,2,2-Trifluoro-1-mesitylethan-1-ol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2,2,2-trifluoro-1-(2,4,6-trimethylphenyl)ethanol (CAS 102626-53-9) is a chemical compound with the molecular formula C11H13F3O and a molecular weight of 218.21 g/mol. IUPAC name: 2,2,2-trifluoro-1-(2,4,6-trimethylphenyl)ethanol. InChIKey: FLVCXPCTCZOGJF-UHFFFAOYSA-N.
| Molecular formula | C11H13F3O |
|---|---|
| Molecular weight | 218.21 g/mol |
| IUPAC name | 2,2,2-trifluoro-1-(2,4,6-trimethylphenyl)ethanol |
| InChIKey | FLVCXPCTCZOGJF-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1)C)C(C(F)(F)F)O)C |
Computed by PubChem (NCBI)