CAS 1026285-45-9 is the registry number for 6-(Dimethylamino)-2,4-dimethylnicotinaldehyde, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
6-(dimethylamino)-2,4-dimethylpyridine-3-carbaldehyde (CAS 1026285-45-9) is a chemical compound with the molecular formula C10H14N2O and a molecular weight of 178.23 g/mol. IUPAC name: 6-(dimethylamino)-2,4-dimethylpyridine-3-carbaldehyde. InChIKey: ZQPDYBAMBJIHJL-UHFFFAOYSA-N.
| Molecular formula | C10H14N2O |
|---|---|
| Molecular weight | 178.23 g/mol |
| IUPAC name | 6-(dimethylamino)-2,4-dimethylpyridine-3-carbaldehyde |
| InChIKey | ZQPDYBAMBJIHJL-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NC(=C1C=O)C)N(C)C |
Computed by PubChem (NCBI)