CAS 1026438-56-1 appears in our catalog under these names: Telmisartan Impurity 5, Telmisartan Isomer t-Butyl Ester, Telmisartan Impurity 21, Telmisartan Impurity B, >95% (HPLC), Telmisartan impurity B. Offered by: Chemat Brand, Hubei YoungXin, TRC, Biosynth, MedChemExpress. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, Get quote.
Tert-butyl 2-[4-[[7-methyl-5-(1-methylbenzimidazol-2-yl)-2-propylbenzimidazol-1-yl]methyl]phenyl]benzoate (CAS 1026438-56-1) is a chemical compound with the molecular formula C37H38N4O2 and a molecular weight of 570.7 g/mol. IUPAC name: tert-butyl 2-[4-[[7-methyl-5-(1-methylbenzimidazol-2-yl)-2-propylbenzimidazol-1-yl]methyl]phenyl]benzoate. InChIKey: ZDOPWPNJFDIROE-UHFFFAOYSA-N.
| Molecular formula | C37H38N4O2 |
|---|---|
| Molecular weight | 570.7 g/mol |
| IUPAC name | tert-butyl 2-[4-[[7-methyl-5-(1-methylbenzimidazol-2-yl)-2-propylbenzimidazol-1-yl]methyl]phenyl]benzoate |
| InChIKey | ZDOPWPNJFDIROE-UHFFFAOYSA-N |
| SMILES | CCCC1=NC2=C(N1CC3=CC=C(C=C3)C4=CC=CC=C4C(=O)OC(C)(C)C)C(=CC(=C2)C5=NC6=CC=CC=C6N5C)C |
Computed by PubChem (NCBI)