Products 1026796-02-0

CAS 1026796-02-0 appears in our catalog under these names: 1-Methylpyrazole-4-boronic acid hydrochloride, 98%, 1-Methyl-1H-pyrazole-4-boronic acid hydrochloride, 95%, (1-Methyl-1H-pyrazol-4-yl)boronic acid hydrochloride 98%, (1-Methyl-1H-pyrazol-4-yl)boronic acid hydrochloride, 98%, 98%, (1-Methyl-1H-pyrazol-4-yl)boronic acid hydrochloride, 98%. Offered by: Combi-blocks, Thermo Scientific (Acros), Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 10g, 25g, 1g.

Structural formula: {0} (CAS {1})

(1-methylpyrazol-4-yl)boronic acid;hydrochloride (CAS 1026796-02-0) is a chemical compound with the molecular formula C4H8BClN2O2 and a molecular weight of 162.38 g/mol. IUPAC name: (1-methylpyrazol-4-yl)boronic acid;hydrochloride. InChIKey: YFPLZINTZVVVJM-UHFFFAOYSA-N.

Identity
Molecular formulaC4H8BClN2O2
Molecular weight162.38 g/mol
IUPAC name(1-methylpyrazol-4-yl)boronic acid;hydrochloride
InChIKeyYFPLZINTZVVVJM-UHFFFAOYSA-N
SMILESB(C1=CN(N=C1)C)(O)O.Cl

Computed by PubChem (NCBI)