Products 1026796-26-8
CAS 1026796-26-8 is the registry number for tert-butyl 5-azaspiro[2.4]heptane-5-carboxylate, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
Tert-butyl 5-azaspiro[2.4]heptane-5-carboxylate (CAS 1026796-26-8) is a chemical compound with the molecular formula C11H19NO2 and a molecular weight of 197.27 g/mol. IUPAC name: tert-butyl 5-azaspiro[2.4]heptane-5-carboxylate. InChIKey: IDGQLKCBXKZRGT-UHFFFAOYSA-N.
| Molecular formula | C11H19NO2 |
|---|---|
| Molecular weight | 197.27 g/mol |
| IUPAC name | tert-butyl 5-azaspiro[2.4]heptane-5-carboxylate |
| InChIKey | IDGQLKCBXKZRGT-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC2(C1)CC2 |
Computed by PubChem (NCBI)