Products 1026796-70-2

CAS 1026796-70-2 is the registry number for 3-Bromo-5-ethoxyphenol, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 25g, 10g, 1g, 250mg.

Structural formula: {0} (CAS {1})

3-bromo-5-ethoxyphenol (CAS 1026796-70-2) is a chemical compound with the molecular formula C8H9BrO2 and a molecular weight of 217.06 g/mol. IUPAC name: 3-bromo-5-ethoxyphenol. InChIKey: YUZHOUVYLSTTRB-UHFFFAOYSA-N.

Identity
Molecular formulaC8H9BrO2
Molecular weight217.06 g/mol
IUPAC name3-bromo-5-ethoxyphenol
InChIKeyYUZHOUVYLSTTRB-UHFFFAOYSA-N
SMILESCCOC1=CC(=CC(=C1)O)Br

Computed by PubChem (NCBI)