CAS 1026796-76-8 is the registry number for Benzyl [1,3'-biazetidin]-3-ylcarbamate dihydrochloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Benzyl N-[1-(azetidin-3-yl)azetidin-3-yl]carbamate;dihydrochloride (CAS 1026796-76-8) is a chemical compound with the molecular formula C14H21Cl2N3O2 and a molecular weight of 334.2 g/mol. IUPAC name: benzyl N-[1-(azetidin-3-yl)azetidin-3-yl]carbamate;dihydrochloride. InChIKey: CCLKBZJTZBGFBA-UHFFFAOYSA-N.
| Molecular formula | C14H21Cl2N3O2 |
|---|---|
| Molecular weight | 334.2 g/mol |
| IUPAC name | benzyl N-[1-(azetidin-3-yl)azetidin-3-yl]carbamate;dihydrochloride |
| InChIKey | CCLKBZJTZBGFBA-UHFFFAOYSA-N |
| SMILES | C1C(CN1)N2CC(C2)NC(=O)OCC3=CC=CC=C3.Cl.Cl |
Computed by PubChem (NCBI)