Products 10268-27-6
CAS 10268-27-6 is the registry number for 1-(4-Chlorophenyl)-6,7-dimethoxy-1,2,3,4-tetrahydroisoquinoline hydrochloride, 95%+, 95%+. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g.
1-(4-chlorophenyl)-6,7-dimethoxy-1,2,3,4-tetrahydroisoquinoline;hydrochloride (CAS 10268-27-6) is a chemical compound with the molecular formula C17H19Cl2NO2 and a molecular weight of 340.2 g/mol. IUPAC name: 1-(4-chlorophenyl)-6,7-dimethoxy-1,2,3,4-tetrahydroisoquinoline;hydrochloride. InChIKey: IDFYITZZJQASAB-UHFFFAOYSA-N.
| Molecular formula | C17H19Cl2NO2 |
|---|---|
| Molecular weight | 340.2 g/mol |
| IUPAC name | 1-(4-chlorophenyl)-6,7-dimethoxy-1,2,3,4-tetrahydroisoquinoline;hydrochloride |
| InChIKey | IDFYITZZJQASAB-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C2C(NCCC2=C1)C3=CC=C(C=C3)Cl)OC.Cl |
Computed by PubChem (NCBI)