CAS 102680-35-3 appears in our catalog under these names: 2–Butenoyl coenzyme A lithium, CROTONOYL COENZYME A LITHIUM, 2-Butenoyl coenzyme A (lithium), 98%. Offered by: GLPBio, Sigma-Aldrich, MedChemExpress. Available pack sizes: 5mg, 10MG, 25MG, 5 mg, 1 mg.
CAS 102680-35-3 identifies a chemical compound with the molecular formula C25H40LiN7O17P3S and a molecular weight of 842.6 g/mol. InChIKey: VVVNZHYHSLNWDW-CVPWVEIMSA-N.
| Molecular formula | C25H40LiN7O17P3S |
|---|---|
| Molecular weight | 842.6 g/mol |
| InChIKey | VVVNZHYHSLNWDW-CVPWVEIMSA-N |
| SMILES | [Li].C/C=C/C(=O)SCCNC(=O)CCNC(=O)[C@@H](C(C)(C)COP(=O)(O)OP(=O)(O)OC[C@@H]1[C@H]([C@H]([C@@H](O1)N2C=NC3=C(N=CN=C32)N)O)OP(=O)(O)O)O |
Computed by PubChem (NCBI)