CAS 1026952-91-9 is the registry number for Levofloxacin Impurity N. Offered by: Chemat Brand. Available pack sizes: on request.
6,7-difluoro-2-methyl-10-oxo-4-oxa-1-azatricyclo[7.3.1.05,13]trideca-5(13),6,8-triene-11-carboxylic acid (CAS 1026952-91-9) is a chemical compound with the molecular formula C13H11F2NO4 and a molecular weight of 283.23 g/mol. IUPAC name: 6,7-difluoro-2-methyl-10-oxo-4-oxa-1-azatricyclo[7.3.1.05,13]trideca-5(13),6,8-triene-11-carboxylic acid. InChIKey: AFPQFERZSHQXSX-UHFFFAOYSA-N.
| Molecular formula | C13H11F2NO4 |
|---|---|
| Molecular weight | 283.23 g/mol |
| IUPAC name | 6,7-difluoro-2-methyl-10-oxo-4-oxa-1-azatricyclo[7.3.1.05,13]trideca-5(13),6,8-triene-11-carboxylic acid |
| InChIKey | AFPQFERZSHQXSX-UHFFFAOYSA-N |
| SMILES | CC1COC2=C3N1CC(C(=O)C3=CC(=C2F)F)C(=O)O |
Computed by PubChem (NCBI)