CAS 1027045-46-0 is the registry number for 2-(4-Iodophenyl)-6-methoxyimidazo[1,2-a]pyridine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(4-iodophenyl)-6-methoxyimidazo[1,2-a]pyridine (CAS 1027045-46-0) is a chemical compound with the molecular formula C14H11IN2O and a molecular weight of 350.15 g/mol. IUPAC name: 2-(4-iodophenyl)-6-methoxyimidazo[1,2-a]pyridine. InChIKey: DSDRDTNCKSMMKB-UHFFFAOYSA-N.
| Molecular formula | C14H11IN2O |
|---|---|
| Molecular weight | 350.15 g/mol |
| IUPAC name | 2-(4-iodophenyl)-6-methoxyimidazo[1,2-a]pyridine |
| InChIKey | DSDRDTNCKSMMKB-UHFFFAOYSA-N |
| SMILES | COC1=CN2C=C(N=C2C=C1)C3=CC=C(C=C3)I |
Computed by PubChem (NCBI)