Products 1027074-52-7
CAS 1027074-52-7 is the registry number for 2-(4-Bromophenyl)-3-Phenylimidazo[1,2-A]Pyridine, ≥96%. Offered by: Chemat. Available pack sizes: 100mg.
2-(4-bromophenyl)-3-phenylimidazo[1,2-a]pyridine (CAS 1027074-52-7) is a chemical compound with the molecular formula C19H13BrN2 and a molecular weight of 349.2 g/mol. IUPAC name: 2-(4-bromophenyl)-3-phenylimidazo[1,2-a]pyridine. InChIKey: MIVKNYUGPASSPY-UHFFFAOYSA-N.
| Molecular formula | C19H13BrN2 |
|---|---|
| Molecular weight | 349.2 g/mol |
| IUPAC name | 2-(4-bromophenyl)-3-phenylimidazo[1,2-a]pyridine |
| InChIKey | MIVKNYUGPASSPY-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=C(N=C3N2C=CC=C3)C4=CC=C(C=C4)Br |
Computed by PubChem (NCBI)