Products 1027102-50-6
CAS 1027102-50-6 is the registry number for UGM-IN-1. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-[[4-(3,4-dichlorophenyl)-1,3-thiazol-2-yl]amino]-3-(4-iodophenyl)propanoic acid (CAS 1027102-50-6) is a chemical compound with the molecular formula C18H13Cl2IN2O2S and a molecular weight of 519.2 g/mol. IUPAC name: 2-[[4-(3,4-dichlorophenyl)-1,3-thiazol-2-yl]amino]-3-(4-iodophenyl)propanoic acid. InChIKey: KCANQQYJEXKIFP-UHFFFAOYSA-N.
| Molecular formula | C18H13Cl2IN2O2S |
|---|---|
| Molecular weight | 519.2 g/mol |
| IUPAC name | 2-[[4-(3,4-dichlorophenyl)-1,3-thiazol-2-yl]amino]-3-(4-iodophenyl)propanoic acid |
| InChIKey | KCANQQYJEXKIFP-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CC(C(=O)O)NC2=NC(=CS2)C3=CC(=C(C=C3)Cl)Cl)I |
Computed by PubChem (NCBI)