CAS 102714-74-9 is the registry number for Terazosin EP Impurity D. Offered by: Chemat Brand. Available pack sizes: on request.
4-(4-amino-6,7-dimethoxyquinazolin-2-yl)piperazine-1-carbaldehyde (CAS 102714-74-9) is a chemical compound with the molecular formula C15H19N5O3 and a molecular weight of 317.34 g/mol. IUPAC name: 4-(4-amino-6,7-dimethoxyquinazolin-2-yl)piperazine-1-carbaldehyde. InChIKey: LYWLXJIJCXEGCI-UHFFFAOYSA-N.
| Molecular formula | C15H19N5O3 |
|---|---|
| Molecular weight | 317.34 g/mol |
| IUPAC name | 4-(4-amino-6,7-dimethoxyquinazolin-2-yl)piperazine-1-carbaldehyde |
| InChIKey | LYWLXJIJCXEGCI-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C2C(=C1)C(=NC(=N2)N3CCN(CC3)C=O)N)OC |
Computed by PubChem (NCBI)