CAS 10273-74-2 is the registry number for P-Xylylenebis(triphenylphosphonium bromide), 97%. Offered by: Combi-blocks. Available pack sizes: 25g, 1g, 100g, 5g.
Triphenyl-[[3-(triphenylphosphaniumylmethyl)phenyl]methyl]phosphanium dibromide (CAS 10273-74-2) is a chemical compound with the molecular formula C44H38Br2P2 and a molecular weight of 788.5 g/mol. IUPAC name: triphenyl-[[3-(triphenylphosphaniumylmethyl)phenyl]methyl]phosphanium dibromide. InChIKey: DQFGPFIQLZTNEK-UHFFFAOYSA-L.
| Molecular formula | C44H38Br2P2 |
|---|---|
| Molecular weight | 788.5 g/mol |
| IUPAC name | triphenyl-[[3-(triphenylphosphaniumylmethyl)phenyl]methyl]phosphanium dibromide |
| InChIKey | DQFGPFIQLZTNEK-UHFFFAOYSA-L |
| SMILES | C1=CC=C(C=C1)[P+](CC2=CC(=CC=C2)C[P+](C3=CC=CC=C3)(C4=CC=CC=C4)C5=CC=CC=C5)(C6=CC=CC=C6)C7=CC=CC=C7.[Br-].[Br-] |
Computed by PubChem (NCBI)