Products 1027400-76-5

CAS 1027400-76-5 is the registry number for 2-Bromo-4-chloro-4-oxo-butanoic Acid Ethyl Ester. Offered by: TRC. Available pack sizes: 2,5g.

Structural formula: {0} (CAS {1})

Ethyl 2-bromo-4-chloro-4-oxobutanoate (CAS 1027400-76-5) is a chemical compound with the molecular formula C6H8BrClO3 and a molecular weight of 243.48 g/mol. IUPAC name: ethyl 2-bromo-4-chloro-4-oxobutanoate. InChIKey: RGORMEWDTGIGAB-UHFFFAOYSA-N.

Identity
Molecular formulaC6H8BrClO3
Molecular weight243.48 g/mol
IUPAC nameethyl 2-bromo-4-chloro-4-oxobutanoate
InChIKeyRGORMEWDTGIGAB-UHFFFAOYSA-N
SMILESCCOC(=O)C(CC(=O)Cl)Br

Computed by PubChem (NCBI)