CAS 1027513-43-4 appears in our catalog under these names: Ethyl 3-fluoro-4-iodobenzoate, 97%, Ethyl 3-fluoro-4-iodobenzoate, 95%, Ethyl 3-fluoro-4-iodobenzoate, 95%, 95%. Offered by: AmBeed, Fluorochem, Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg.
Ethyl 3-fluoro-4-iodobenzoate (CAS 1027513-43-4) is a chemical compound with the molecular formula C9H8FIO2 and a molecular weight of 294.06 g/mol. IUPAC name: ethyl 3-fluoro-4-iodobenzoate. InChIKey: YKLQREFLOXXOCG-UHFFFAOYSA-N.
| Molecular formula | C9H8FIO2 |
|---|---|
| Molecular weight | 294.06 g/mol |
| IUPAC name | ethyl 3-fluoro-4-iodobenzoate |
| InChIKey | YKLQREFLOXXOCG-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC(=C(C=C1)I)F |
Computed by PubChem (NCBI)