CAS 1027529-99-2 appears in our catalog under these names: Vilanterol Impurity 25, (S)-5-(2,2-Dimethyl-4H-benzo[d][1,3]dioxin-5-yl)oxazolidin-2-one, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
(5S)-5-(2,2-dimethyl-4H-1,3-benzodioxin-5-yl)-1,3-oxazolidin-2-one (CAS 1027529-99-2) is a chemical compound with the molecular formula C13H15NO4 and a molecular weight of 249.26 g/mol. IUPAC name: (5S)-5-(2,2-dimethyl-4H-1,3-benzodioxin-5-yl)-1,3-oxazolidin-2-one. InChIKey: ZBVJIPQYIQFWGZ-LLVKDONJSA-N.
| Molecular formula | C13H15NO4 |
|---|---|
| Molecular weight | 249.26 g/mol |
| IUPAC name | (5S)-5-(2,2-dimethyl-4H-1,3-benzodioxin-5-yl)-1,3-oxazolidin-2-one |
| InChIKey | ZBVJIPQYIQFWGZ-LLVKDONJSA-N |
| SMILES | CC1(OCC2=C(C=CC=C2O1)[C@H]3CNC(=O)O3)C |
Computed by PubChem (NCBI)