CAS 10276-33-2 is the registry number for Adenosine Impurity 4. Offered by: Chemat Brand. Available pack sizes: on request.
[(2R,3R,4R,5R)-5-(6-aminopurin-9-yl)-3,4-diphosphonooxyoxolan-2-yl]methyl dihydrogen phosphate (CAS 10276-33-2) is a chemical compound with the molecular formula C10H16N5O13P3 and a molecular weight of 507.18 g/mol. IUPAC name: [(2R,3R,4R,5R)-5-(6-aminopurin-9-yl)-3,4-diphosphonooxyoxolan-2-yl]methyl dihydrogen phosphate. InChIKey: JRIZSBGDMDSKRF-KQYNXXCUSA-N.
| Molecular formula | C10H16N5O13P3 |
|---|---|
| Molecular weight | 507.18 g/mol |
| IUPAC name | [(2R,3R,4R,5R)-5-(6-aminopurin-9-yl)-3,4-diphosphonooxyoxolan-2-yl]methyl dihydrogen phosphate |
| InChIKey | JRIZSBGDMDSKRF-KQYNXXCUSA-N |
| SMILES | C1=NC(=C2C(=N1)N(C=N2)[C@H]3[C@@H]([C@@H]([C@H](O3)COP(=O)(O)O)OP(=O)(O)O)OP(=O)(O)O)N |
Computed by PubChem (NCBI)