CAS 1027642-28-9 appears in our catalog under these names: Potassium (2-Trimethylsilyl)-ethoxymethyl trifluoroborate, 97%, Potassium (2-trimethylsilyl)ethoxymethyl trifluoroborate, 97%, 97%, Potassium trifluoro((2-(trimethylsilyl)ethoxy)methyl)borate, 97%, Potassium (2-trimethylsilyl)ethoxymethyl trifluoroborate, 95%. Offered by: Combi-blocks, Chemat, Fluorochem, Ambeed. Available pack sizes: 5g, 25g, 10g, 1g, 100mg, 250mg, 100g.
Potassium trifluoro(2-trimethylsilylethoxymethyl)boranuide (CAS 1027642-28-9) is a chemical compound with the molecular formula C6H15BF3KOSi and a molecular weight of 238.17 g/mol. IUPAC name: potassium trifluoro(2-trimethylsilylethoxymethyl)boranuide. InChIKey: DJFAQXNICJQMDJ-UHFFFAOYSA-N.
| Molecular formula | C6H15BF3KOSi |
|---|---|
| Molecular weight | 238.17 g/mol |
| IUPAC name | potassium trifluoro(2-trimethylsilylethoxymethyl)boranuide |
| InChIKey | DJFAQXNICJQMDJ-UHFFFAOYSA-N |
| SMILES | [B-](COCC[Si](C)(C)C)(F)(F)F.[K+] |
Computed by PubChem (NCBI)