CAS 1027642-43-8 appears in our catalog under these names: BAY 60-2770, 98%, BAY 60–2770, BAY 60-2770, 98.97%, 98.97%, BAY 60-2770, 98.15%. Offered by: AmBeed, GLPBio, Chemat, MedChemExpress. Available pack sizes: 100mg, 10mg, 25mg, 5mg, 50mg, 1mg, 50 mg, 5 mg.
4-[[4-carboxybutyl-[2-[5-fluoro-2-[[4-[4-(trifluoromethyl)phenyl]phenyl]methoxy]phenyl]ethyl]amino]methyl]benzoic acid (CAS 1027642-43-8) is a chemical compound with the molecular formula C35H33F4NO5 and a molecular weight of 623.6 g/mol. IUPAC name: 4-[[4-carboxybutyl-[2-[5-fluoro-2-[[4-[4-(trifluoromethyl)phenyl]phenyl]methoxy]phenyl]ethyl]amino]methyl]benzoic acid. InChIKey: CRQMDXFUKDWARU-UHFFFAOYSA-N.
| Molecular formula | C35H33F4NO5 |
|---|---|
| Molecular weight | 623.6 g/mol |
| IUPAC name | 4-[[4-carboxybutyl-[2-[5-fluoro-2-[[4-[4-(trifluoromethyl)phenyl]phenyl]methoxy]phenyl]ethyl]amino]methyl]benzoic acid |
| InChIKey | CRQMDXFUKDWARU-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CN(CCCCC(=O)O)CCC2=C(C=CC(=C2)F)OCC3=CC=C(C=C3)C4=CC=C(C=C4)C(F)(F)F)C(=O)O |
Computed by PubChem (NCBI)