CAS 102771-00-6 appears in our catalog under these names: 2-Iodo-5-(trifluoromethyl)phenol, 95%, 2-Iodo-5-(trifluoromethyl)phenol, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 5g.
2-iodo-5-(trifluoromethyl)phenol (CAS 102771-00-6) is a chemical compound with the molecular formula C7H4F3IO and a molecular weight of 288.01 g/mol. IUPAC name: 2-iodo-5-(trifluoromethyl)phenol. InChIKey: CWSAPAHVCIIVDH-UHFFFAOYSA-N.
| Molecular formula | C7H4F3IO |
|---|---|
| Molecular weight | 288.01 g/mol |
| IUPAC name | 2-iodo-5-(trifluoromethyl)phenol |
| InChIKey | CWSAPAHVCIIVDH-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(F)(F)F)O)I |
Computed by PubChem (NCBI)