Products 1027754-80-8
CAS 1027754-80-8 is the registry number for 3-Amino-n,n-diethyl-5-(trifluoromethyl)benzamide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
3-amino-N,N-diethyl-5-(trifluoromethyl)benzamide (CAS 1027754-80-8) is a chemical compound with the molecular formula C12H15F3N2O and a molecular weight of 260.26 g/mol. IUPAC name: 3-amino-N,N-diethyl-5-(trifluoromethyl)benzamide. InChIKey: OTINPMSBJLJZAA-UHFFFAOYSA-N.
| Molecular formula | C12H15F3N2O |
|---|---|
| Molecular weight | 260.26 g/mol |
| IUPAC name | 3-amino-N,N-diethyl-5-(trifluoromethyl)benzamide |
| InChIKey | OTINPMSBJLJZAA-UHFFFAOYSA-N |
| SMILES | CCN(CC)C(=O)C1=CC(=CC(=C1)N)C(F)(F)F |
Computed by PubChem (NCBI)