CAS 1027929-81-2 appears in our catalog under these names: 7-Fluoro-8-nitroquinazolin-4(3h)-one, 95%, Afatinib Impurity 58, 7–Fluoro–8–nitroquinazolin–4(3H)–one, 7-Fluoro-8-nitroquinazolin-4(3H)-one. Offered by: Combi-blocks, Chemat Brand, GLPBio, Biosynth. Available pack sizes: 1g, 100mg, 250mg, on request, 5g, 1000mg, 5000mg.
7-fluoro-8-nitro-3H-quinazolin-4-one (CAS 1027929-81-2) is a chemical compound with the molecular formula C8H4FN3O3 and a molecular weight of 209.13 g/mol. IUPAC name: 7-fluoro-8-nitro-3H-quinazolin-4-one. InChIKey: CJBKDJKOXRYRRV-UHFFFAOYSA-N.
| Molecular formula | C8H4FN3O3 |
|---|---|
| Molecular weight | 209.13 g/mol |
| IUPAC name | 7-fluoro-8-nitro-3H-quinazolin-4-one |
| InChIKey | CJBKDJKOXRYRRV-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C2=C1C(=O)NC=N2)[N+](=O)[O-])F |
Computed by PubChem (NCBI)