CAS 1028126-98-8 appears in our catalog under these names: (2-[(4-Fluorophenyl)sulfonyl]ethyl)amine hydrochloride, 95%, 2-(4-Fluoro-benzenesulfonyl)-ethylaminehydrochloride. Offered by: Combi-blocks, Biosynth. Available pack sizes: 10g, 5g, 250mg, 1g, 2,5g.
2-(4-fluorophenyl)sulfonylethanamine;hydrochloride (CAS 1028126-98-8) is a chemical compound with the molecular formula C8H11ClFNO2S and a molecular weight of 239.70 g/mol. IUPAC name: 2-(4-fluorophenyl)sulfonylethanamine;hydrochloride. InChIKey: DPTCRXQCFJRKIS-UHFFFAOYSA-N.
| Molecular formula | C8H11ClFNO2S |
|---|---|
| Molecular weight | 239.70 g/mol |
| IUPAC name | 2-(4-fluorophenyl)sulfonylethanamine;hydrochloride |
| InChIKey | DPTCRXQCFJRKIS-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1F)S(=O)(=O)CCN.Cl |
Computed by PubChem (NCBI)