Products 102848-86-2
CAS 102848-86-2 is the registry number for 2-Naphthyl-2,3,4-tri-O-acetyl-beta-D-glucuronic acid methyl ester, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl (2S,3S,4S,5R,6S)-3,4,5-triacetyloxy-6-naphthalen-2-yloxyoxane-2-carboxylate (CAS 102848-86-2) is a chemical compound with the molecular formula C23H24O10 and a molecular weight of 460.4 g/mol. IUPAC name: methyl (2S,3S,4S,5R,6S)-3,4,5-triacetyloxy-6-naphthalen-2-yloxyoxane-2-carboxylate. InChIKey: KXUBRZDZJIHNKD-YKZCJQPKSA-N.
| Molecular formula | C23H24O10 |
|---|---|
| Molecular weight | 460.4 g/mol |
| IUPAC name | methyl (2S,3S,4S,5R,6S)-3,4,5-triacetyloxy-6-naphthalen-2-yloxyoxane-2-carboxylate |
| InChIKey | KXUBRZDZJIHNKD-YKZCJQPKSA-N |
| SMILES | CC(=O)O[C@H]1[C@@H]([C@H](O[C@H]([C@@H]1OC(=O)C)OC2=CC3=CC=CC=C3C=C2)C(=O)OC)OC(=O)C |
Computed by PubChem (NCBI)