CAS 102852-91-5 is the registry number for 1,3,5-Tris(4-nitrophenoxy)benzene, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
1,3,5-tris(4-nitrophenoxy)benzene (CAS 102852-91-5) is a chemical compound with the molecular formula C24H15N3O9 and a molecular weight of 489.4 g/mol. IUPAC name: 1,3,5-tris(4-nitrophenoxy)benzene. InChIKey: DXYUVOVIDRJKFE-UHFFFAOYSA-N.
| Molecular formula | C24H15N3O9 |
|---|---|
| Molecular weight | 489.4 g/mol |
| IUPAC name | 1,3,5-tris(4-nitrophenoxy)benzene |
| InChIKey | DXYUVOVIDRJKFE-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1[N+](=O)[O-])OC2=CC(=CC(=C2)OC3=CC=C(C=C3)[N+](=O)[O-])OC4=CC=C(C=C4)[N+](=O)[O-] |
Computed by PubChem (NCBI)