CAS 1028647-98-4 is the registry number for N,N-Di([1,1'-biphenyl]-4-yl)-7-bromo-9,9-dimethyl-9H-fluoren-2-amine, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
7-bromo-9,9-dimethyl-N,N-bis(4-phenylphenyl)fluoren-2-amine (CAS 1028647-98-4) is a chemical compound with the molecular formula C39H30BrN and a molecular weight of 592.6 g/mol. IUPAC name: 7-bromo-9,9-dimethyl-N,N-bis(4-phenylphenyl)fluoren-2-amine. InChIKey: NQFPFBSWSHEREA-UHFFFAOYSA-N.
| Molecular formula | C39H30BrN |
|---|---|
| Molecular weight | 592.6 g/mol |
| IUPAC name | 7-bromo-9,9-dimethyl-N,N-bis(4-phenylphenyl)fluoren-2-amine |
| InChIKey | NQFPFBSWSHEREA-UHFFFAOYSA-N |
| SMILES | CC1(C2=C(C=CC(=C2)N(C3=CC=C(C=C3)C4=CC=CC=C4)C5=CC=C(C=C5)C6=CC=CC=C6)C7=C1C=C(C=C7)Br)C |
Computed by PubChem (NCBI)