CAS 1029008-73-8 appears in our catalog under these names: N7,N7-Dimethyl-3-(m-tolyl)isoquinoline-1,7-diamine, 98%, N7,N7-Dimethyl-3-(3-Methylphenyl)-1,7-Isoquinolinediamine, 98%, 98%, N7,N7-Dimethyl-3-m-tolylisoquinoline-1,7-diamine, 99.09%, N7,N7-Dimethyl-3-(3-methylphenyl)-1,7-isoquinolinediamine, 98%. Offered by: AmBeed, Chemat, MedChemExpress, Fluorochem. Available pack sizes: 1g, 50mg, 100mg, 250mg, 1 g, 250 mg, 500 mg, 100 mg.
7-N,7-N-dimethyl-3-(3-methylphenyl)isoquinoline-1,7-diamine (CAS 1029008-73-8) is a chemical compound with the molecular formula C18H19N3 and a molecular weight of 277.4 g/mol. IUPAC name: 7-N,7-N-dimethyl-3-(3-methylphenyl)isoquinoline-1,7-diamine. InChIKey: CHKVCLVBUNSRFG-UHFFFAOYSA-N.
| Molecular formula | C18H19N3 |
|---|---|
| Molecular weight | 277.4 g/mol |
| IUPAC name | 7-N,7-N-dimethyl-3-(3-methylphenyl)isoquinoline-1,7-diamine |
| InChIKey | CHKVCLVBUNSRFG-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC=C1)C2=NC(=C3C=C(C=CC3=C2)N(C)C)N |
Computed by PubChem (NCBI)