Products 1029134-73-3
CAS 1029134-73-3 appears in our catalog under these names: Ramelteon Impurity N, Ramelteon Impurity 36. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
2-[(8R)-2,6,7,8-tetrahydro-1H-cyclopenta[e][1]benzofuran-8-yl]ethanamine (CAS 1029134-73-3) is a chemical compound with the molecular formula C13H17NO and a molecular weight of 203.28 g/mol. IUPAC name: 2-[(8R)-2,6,7,8-tetrahydro-1H-cyclopenta[e][1]benzofuran-8-yl]ethanamine. InChIKey: BFNUHWYOQCGTCA-SNVBAGLBSA-N.
| Molecular formula | C13H17NO |
|---|---|
| Molecular weight | 203.28 g/mol |
| IUPAC name | 2-[(8R)-2,6,7,8-tetrahydro-1H-cyclopenta[e][1]benzofuran-8-yl]ethanamine |
| InChIKey | BFNUHWYOQCGTCA-SNVBAGLBSA-N |
| SMILES | C1CC2=C([C@H]1CCN)C3=C(C=C2)OCC3 |
Computed by PubChem (NCBI)