CAS 1029324-91-1 appears in our catalog under these names: Brinzolamide Impurity 13, Brinzolamide Impurity 26, (4S)-3,4-Dihydro-2-(3-methoxypropyl)-2H-thieno(3,2-e)-1,2-thiazin-4-ol 1,1-dioxide. Offered by: Chemat Brand, Biosynth. Available pack sizes: on request, 50mg, 25mg, 100mg.
(4S)-2-(3-methoxypropyl)-1,1-dioxo-3,4-dihydrothieno[3,2-e]thiazin-4-ol (CAS 1029324-91-1) is a chemical compound with the molecular formula C10H15NO4S2 and a molecular weight of 277.4 g/mol. IUPAC name: (4S)-2-(3-methoxypropyl)-1,1-dioxo-3,4-dihydrothieno[3,2-e]thiazin-4-ol. InChIKey: XXDPMCCGFXTPIS-SECBINFHSA-N.
| Molecular formula | C10H15NO4S2 |
|---|---|
| Molecular weight | 277.4 g/mol |
| IUPAC name | (4S)-2-(3-methoxypropyl)-1,1-dioxo-3,4-dihydrothieno[3,2-e]thiazin-4-ol |
| InChIKey | XXDPMCCGFXTPIS-SECBINFHSA-N |
| SMILES | COCCCN1C[C@H](C2=C(S1(=O)=O)SC=C2)O |
Computed by PubChem (NCBI)