CAS 1029401-59-9 appears in our catalog under these names: Golotimod HCl, Golotimod hydrochloride, Golotimod HCl 98%, Golotimod (hydrochloride), 98%, 98%, Golotimod (hydrochloride), 99.79%. Offered by: AmBeed, GLPBio, Chemat, MedChemExpress. Available pack sizes: 5mg, 10mg, 100mg, 10mM (in 1ml water), 50mg, 250mg, 100 mg, 50 mg.
(2R)-2-amino-5-[[(1S)-1-carboxy-2-(1H-indol-3-yl)ethyl]amino]-5-oxopentanoic acid;hydrochloride (CAS 1029401-59-9) is a chemical compound with the molecular formula C16H20ClN3O5 and a molecular weight of 369.80 g/mol. IUPAC name: (2R)-2-amino-5-[[(1S)-1-carboxy-2-(1H-indol-3-yl)ethyl]amino]-5-oxopentanoic acid;hydrochloride. InChIKey: YYTBHYZPAMPQGT-YLAFAASESA-N.
| Molecular formula | C16H20ClN3O5 |
|---|---|
| Molecular weight | 369.80 g/mol |
| IUPAC name | (2R)-2-amino-5-[[(1S)-1-carboxy-2-(1H-indol-3-yl)ethyl]amino]-5-oxopentanoic acid;hydrochloride |
| InChIKey | YYTBHYZPAMPQGT-YLAFAASESA-N |
| SMILES | C1=CC=C2C(=C1)C(=CN2)C[C@@H](C(=O)O)NC(=O)CC[C@H](C(=O)O)N.Cl |
Computed by PubChem (NCBI)