CAS 1029438-51-4 appears in our catalog under these names: 4-(3,5-Difluorophenoxy)phenylboronic acid, 95%, (4-(3,5-Difluorophenoxy)phenyl)boronic acid 98%, (4-(3,5-Difluorophenoxy)phenyl)boronic acid, 98%, (4-(3,5-Difluorophenoxy)phenyl)boronic acid, 98%, 98%. Offered by: Combi-blocks, Ambeed, Fluorochem, Chemat. Available pack sizes: 250mg, 5g, 1g, 100mg.
[4-(3,5-difluorophenoxy)phenyl]boronic acid (CAS 1029438-51-4) is a chemical compound with the molecular formula C12H9BF2O3 and a molecular weight of 250.01 g/mol. IUPAC name: [4-(3,5-difluorophenoxy)phenyl]boronic acid. InChIKey: LIKIWPBJKMQKEP-UHFFFAOYSA-N.
| Molecular formula | C12H9BF2O3 |
|---|---|
| Molecular weight | 250.01 g/mol |
| IUPAC name | [4-(3,5-difluorophenoxy)phenyl]boronic acid |
| InChIKey | LIKIWPBJKMQKEP-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)OC2=CC(=CC(=C2)F)F)(O)O |
Computed by PubChem (NCBI)