Products 1029439-59-5
CAS 1029439-59-5 appears in our catalog under these names: (4-((3,4-Dihydroquinolin-1(2h)-yl)methyl)phenyl)boronic acid, 95%, (4-((3,4-dihydroquinolin-1(2H)-yl)methyl)phenyl)boronic acid, 95-<97%, (4-((3,4-Dihydroquinolin-1(2h)-yl)methyl)phenyl)boronic acid, 98%, (4–((3，4–dihydroquinolin–1(2H)–yl)methyl)phenyl)boronic acid, B-[4-[(3,4-Dihydro-1(2H)-Quinolinyl)Methyl]Phenyl]Boronic Acid. Offered by: Combi-blocks, Hoffman Fine Chemicals, AmBeed, GLPBio, Chemat. Available pack sizes: 1g, 250mg, 2,5g, 5g, 10g, 25g, 50g, 100mg.
[4-(3,4-dihydro-2H-quinolin-1-ylmethyl)phenyl]boronic acid (CAS 1029439-59-5) is a chemical compound with the molecular formula C16H18BNO2 and a molecular weight of 267.1 g/mol. IUPAC name: [4-(3,4-dihydro-2H-quinolin-1-ylmethyl)phenyl]boronic acid. InChIKey: RSHIIKLHMGRVDA-UHFFFAOYSA-N.
| Molecular formula | C16H18BNO2 |
|---|---|
| Molecular weight | 267.1 g/mol |
| IUPAC name | [4-(3,4-dihydro-2H-quinolin-1-ylmethyl)phenyl]boronic acid |
| InChIKey | RSHIIKLHMGRVDA-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)CN2CCCC3=CC=CC=C32)(O)O |
Computed by PubChem (NCBI)