CAS 1029439-61-9 appears in our catalog under these names: (4-((Naphthalen-1-ylamino)methyl)phenyl)boronic acid, 95%, (4-((Naphthalen-1-ylamino)methyl)phenyl)boronic acid, 98%, (4–((naphthalen–1–ylamino)methyl)phenyl)boronic acid, (4-((naphthalen-1-ylamino)methyl)phenyl)boronic acid, 95%, 95%. Offered by: Combi-blocks, AmBeed, GLPBio, Chemat. Available pack sizes: 5g, 1g, 250mg.
[4-[(naphthalen-1-ylamino)methyl]phenyl]boronic acid (CAS 1029439-61-9) is a chemical compound with the molecular formula C17H16BNO2 and a molecular weight of 277.1 g/mol. IUPAC name: [4-[(naphthalen-1-ylamino)methyl]phenyl]boronic acid. InChIKey: BSMMKWBLXDFJMG-UHFFFAOYSA-N.
| Molecular formula | C17H16BNO2 |
|---|---|
| Molecular weight | 277.1 g/mol |
| IUPAC name | [4-[(naphthalen-1-ylamino)methyl]phenyl]boronic acid |
| InChIKey | BSMMKWBLXDFJMG-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)CNC2=CC=CC3=CC=CC=C32)(O)O |
Computed by PubChem (NCBI)