CAS 102951-20-2 is the registry number for Acepromazine-OTs. Offered by: MedChemExpress. Available pack sizes: Get quote.
3-(2-acetylphenothiazin-10-yl)propyl 4-methylbenzenesulfonate (CAS 102951-20-2) is a chemical compound with the molecular formula C24H23NO4S2 and a molecular weight of 453.6 g/mol. IUPAC name: 3-(2-acetylphenothiazin-10-yl)propyl 4-methylbenzenesulfonate. InChIKey: RFPSPVVNVQOAKX-UHFFFAOYSA-N.
| Molecular formula | C24H23NO4S2 |
|---|---|
| Molecular weight | 453.6 g/mol |
| IUPAC name | 3-(2-acetylphenothiazin-10-yl)propyl 4-methylbenzenesulfonate |
| InChIKey | RFPSPVVNVQOAKX-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)OCCCN2C3=CC=CC=C3SC4=C2C=C(C=C4)C(=O)C |
Computed by PubChem (NCBI)