CAS 1029654-19-0 appears in our catalog under these names: 2-Fluoro-6-phenylpyridine-3-boronic acid, 96%, (2-Fluoro-6-phenylpyridin-3-yl)boronic acid, 98%, 2–Fluoro–6–phenylpyridine–3–boronic Acid. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 100mg, 5g, 1g, 250mg, 25mg.
(2-fluoro-6-phenyl-3-pyridinyl)boronic acid (CAS 1029654-19-0) is a chemical compound with the molecular formula C11H9BFNO2 and a molecular weight of 217.01 g/mol. IUPAC name: (2-fluoro-6-phenyl-3-pyridinyl)boronic acid. InChIKey: HTCDYRMNZQWTIJ-UHFFFAOYSA-N.
| Molecular formula | C11H9BFNO2 |
|---|---|
| Molecular weight | 217.01 g/mol |
| IUPAC name | (2-fluoro-6-phenyl-3-pyridinyl)boronic acid |
| InChIKey | HTCDYRMNZQWTIJ-UHFFFAOYSA-N |
| SMILES | B(C1=C(N=C(C=C1)C2=CC=CC=C2)F)(O)O |
Computed by PubChem (NCBI)