CAS 1029691-10-8 is the registry number for (S)-2-Amino-1,2,3,4-tetrahydrocyclopenta[b]indole-7-carbonitrile, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(2S)-2-amino-1,2,3,4-tetrahydrocyclopenta[b]indole-7-carbonitrile (CAS 1029691-10-8) is a chemical compound with the molecular formula C12H11N3 and a molecular weight of 197.24 g/mol. IUPAC name: (2S)-2-amino-1,2,3,4-tetrahydrocyclopenta[b]indole-7-carbonitrile. InChIKey: UGVXXDSOHKIRJX-QMMMGPOBSA-N.
| Molecular formula | C12H11N3 |
|---|---|
| Molecular weight | 197.24 g/mol |
| IUPAC name | (2S)-2-amino-1,2,3,4-tetrahydrocyclopenta[b]indole-7-carbonitrile |
| InChIKey | UGVXXDSOHKIRJX-QMMMGPOBSA-N |
| SMILES | C1[C@@H](CC2=C1C3=C(N2)C=CC(=C3)C#N)N |
Computed by PubChem (NCBI)