CAS 10297-21-9 is the registry number for Dechlorane Plus Monoadduct, >95% (GC). Offered by: TRC. Available pack sizes: 100mg, 10mg, 50mg.
(1R,2R,5Z,9S,10S)-1,10,11,12,13,13-hexachlorotricyclo[8.2.1.02,9]trideca-5,11-diene (CAS 10297-21-9) is a chemical compound with the molecular formula C13H12Cl6 and a molecular weight of 380.9 g/mol. IUPAC name: (1R,2R,5Z,9S,10S)-1,10,11,12,13,13-hexachlorotricyclo[8.2.1.02,9]trideca-5,11-diene. InChIKey: LHUMZYHABWGTAF-OEWTVGTHSA-N.
| Molecular formula | C13H12Cl6 |
|---|---|
| Molecular weight | 380.9 g/mol |
| IUPAC name | (1R,2R,5Z,9S,10S)-1,10,11,12,13,13-hexachlorotricyclo[8.2.1.02,9]trideca-5,11-diene |
| InChIKey | LHUMZYHABWGTAF-OEWTVGTHSA-N |
| SMILES | C/1C[C@@H]2[C@H](CC/C=C1)[C@@]3(C(=C([C@]2(C3(Cl)Cl)Cl)Cl)Cl)Cl |
Computed by PubChem (NCBI)