CAS 1029701-30-1 is the registry number for (R)-3-Methyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butan-1-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-methyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butan-1-amine (CAS 1029701-30-1) is a chemical compound with the molecular formula C11H24BNO2 and a molecular weight of 213.13 g/mol. IUPAC name: 3-methyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butan-1-amine. InChIKey: DGBIXWGLQXUYLP-UHFFFAOYSA-N.
| Molecular formula | C11H24BNO2 |
|---|---|
| Molecular weight | 213.13 g/mol |
| IUPAC name | 3-methyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butan-1-amine |
| InChIKey | DGBIXWGLQXUYLP-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C(CC(C)C)N |
Computed by PubChem (NCBI)