CAS 1030018-90-6 appears in our catalog under these names: 5-nitro-1H-pyrazol-3-amine hydrochloride, 98%, 5-Nitro-1H-pyrazol-3-amine hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 10g, 5g, 0,5g, 50mg.
5-nitro-1H-pyrazol-3-amine;hydrochloride (CAS 1030018-90-6) is a chemical compound with the molecular formula C3H5ClN4O2 and a molecular weight of 164.55 g/mol. IUPAC name: 5-nitro-1H-pyrazol-3-amine;hydrochloride. InChIKey: HSXUKDIZZNLTSP-UHFFFAOYSA-N.
| Molecular formula | C3H5ClN4O2 |
|---|---|
| Molecular weight | 164.55 g/mol |
| IUPAC name | 5-nitro-1H-pyrazol-3-amine;hydrochloride |
| InChIKey | HSXUKDIZZNLTSP-UHFFFAOYSA-N |
| SMILES | C1=C(NN=C1N)[N+](=O)[O-].Cl |
Computed by PubChem (NCBI)