CAS 103026-49-9 is the registry number for 7-Cyclopentyl-5,6-dimethyl-7H-pyrrolo(2,3-d)pyrimidin-4-ol. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
7-cyclopentyl-5,6-dimethyl-3H-pyrrolo[2,3-d]pyrimidin-4-one (CAS 103026-49-9) is a chemical compound with the molecular formula C13H17N3O and a molecular weight of 231.29 g/mol. IUPAC name: 7-cyclopentyl-5,6-dimethyl-3H-pyrrolo[2,3-d]pyrimidin-4-one. InChIKey: MMVXYEXGOQRXMM-UHFFFAOYSA-N.
| Molecular formula | C13H17N3O |
|---|---|
| Molecular weight | 231.29 g/mol |
| IUPAC name | 7-cyclopentyl-5,6-dimethyl-3H-pyrrolo[2,3-d]pyrimidin-4-one |
| InChIKey | MMVXYEXGOQRXMM-UHFFFAOYSA-N |
| SMILES | CC1=C(N(C2=C1C(=O)NC=N2)C3CCCC3)C |
Computed by PubChem (NCBI)