Products 1030377-32-2
CAS 1030377-32-2 appears in our catalog under these names: Suvorexant Impurity 2, (R)-(7-Methyl-1,4-diazepan-1-yl)(5-methyl-2-(2H-1,2,3-triazol-2-yl)phenyl)methanone, 98%, 98%. Offered by: Hubei YoungXin, Chemat. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg, 1g, 5g, 10g.
[(7R)-7-methyl-1,4-diazepan-1-yl]-[5-methyl-2-(triazol-2-yl)phenyl]methanone (CAS 1030377-32-2) is a chemical compound with the molecular formula C16H21N5O and a molecular weight of 299.37 g/mol. IUPAC name: [(7R)-7-methyl-1,4-diazepan-1-yl]-[5-methyl-2-(triazol-2-yl)phenyl]methanone. InChIKey: FURCQDWTOXYTNN-CYBMUJFWSA-N.
| Molecular formula | C16H21N5O |
|---|---|
| Molecular weight | 299.37 g/mol |
| IUPAC name | [(7R)-7-methyl-1,4-diazepan-1-yl]-[5-methyl-2-(triazol-2-yl)phenyl]methanone |
| InChIKey | FURCQDWTOXYTNN-CYBMUJFWSA-N |
| SMILES | C[C@@H]1CCNCCN1C(=O)C2=C(C=CC(=C2)C)N3N=CC=N3 |
Computed by PubChem (NCBI)