CAS 1030431-29-8 is the registry number for 2-Methyl-3,4-dihydro-2h-thieno[2,3-e][1,2]thiazin-4-ol 1,1-dioxide, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
2-methyl-1,1-dioxo-3,4-dihydrothieno[2,3-e]thiazin-4-ol (CAS 1030431-29-8) is a chemical compound with the molecular formula C7H9NO3S2 and a molecular weight of 219.3 g/mol. IUPAC name: 2-methyl-1,1-dioxo-3,4-dihydrothieno[2,3-e]thiazin-4-ol. InChIKey: ZGUQGHZTQDUGBD-UHFFFAOYSA-N.
| Molecular formula | C7H9NO3S2 |
|---|---|
| Molecular weight | 219.3 g/mol |
| IUPAC name | 2-methyl-1,1-dioxo-3,4-dihydrothieno[2,3-e]thiazin-4-ol |
| InChIKey | ZGUQGHZTQDUGBD-UHFFFAOYSA-N |
| SMILES | CN1CC(C2=C(S1(=O)=O)C=CS2)O |
Computed by PubChem (NCBI)