Products 1030509-01-3
CAS 1030509-01-3 is the registry number for A1AR antagonist 5. Offered by: MedChemExpress. Available pack sizes: Get quote.
5-(4-chlorophenyl)-2-pyrrolidin-1-yl-3H-pyrido[2,3-d]pyrimidin-4-one (CAS 1030509-01-3) is a chemical compound with the molecular formula C17H15ClN4O and a molecular weight of 326.8 g/mol. IUPAC name: 5-(4-chlorophenyl)-2-pyrrolidin-1-yl-3H-pyrido[2,3-d]pyrimidin-4-one. InChIKey: DWHZEYYOVXBBBO-UHFFFAOYSA-N.
| Molecular formula | C17H15ClN4O |
|---|---|
| Molecular weight | 326.8 g/mol |
| IUPAC name | 5-(4-chlorophenyl)-2-pyrrolidin-1-yl-3H-pyrido[2,3-d]pyrimidin-4-one |
| InChIKey | DWHZEYYOVXBBBO-UHFFFAOYSA-N |
| SMILES | C1CCN(C1)C2=NC3=NC=CC(=C3C(=O)N2)C4=CC=C(C=C4)Cl |
Computed by PubChem (NCBI)